C23H18ClF3N4O4 — CID 123228886
4-[4-(9-chloro-2-oxo-4H-[1,3]oxazino[5,4-c]quinolin-1-yl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid (PubChem CID 123228886) has the molecular formula C23H18ClF3N4O4 and a molecular weight of 506.87 g/mol. Its IUPAC name is 4-[4-(9-chloro-2-oxo-4H-[1,3]oxazino[5,4-c]quinolin-1-yl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-(9-chloro-2-oxo-4H-[1,3]oxazino[5,4-c]quinolin-1-yl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 123228886 |
| Molecular Formula | C23H18ClF3N4O4 |
| Molecular Weight | 506.87 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 4-[4-(9-chloro-2-oxo-4H-[1,3]oxazino[5,4-c]quinolin-1-yl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2ccc(N3C(=O)OCc4cnc5ccc(Cl)cc5c43)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H18ClF3N4O4/c24-14-1-3-18-16(9-14)20-13(11-28-18)12-35-22(34)31(20)15-2-4-19(17(10-15)23(25,26)27)29-5-7-30(8-6-29)21(32)33/h1-4,9-11H,5-8,12H2,(H,32,33) |
| InChIKey | QZHMJAUIFHTWIO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.87 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|