C14H23NO4 — CID 123229795
5-(2-amino-1-hydroxypropyl)-2-pentoxybenzene-1,3-diol (PubChem CID 123229795) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 5-(2-amino-1-hydroxypropyl)-2-pentoxybenzene-1,3-diol.
| Compound Name | 5-(2-amino-1-hydroxypropyl)-2-pentoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 123229795 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 5-(2-amino-1-hydroxypropyl)-2-pentoxybenzene-1,3-diol |
| SMILES | CCCCCOc1c(O)cc(C(O)C(C)N)cc1O |
| InChI | InChI=1S/C14H23NO4/c1-3-4-5-6-19-14-11(16)7-10(8-12(14)17)13(18)9(2)15/h7-9,13,16-18H,3-6,15H2,1-2H3 |
| InChIKey | HMOLNMLRXGZZIQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|