C19H27ClN4O2 — CID 123232359
tert-butyl N-[1-(5-chloro-6-cyano-4-ethyl-3-pyridinyl)-2-methylpiperidin-3-yl]carbamate (PubChem CID 123232359) has the molecular formula C19H27ClN4O2 and a molecular weight of 378.90 g/mol. Its IUPAC name is tert-butyl N-[1-(5-chloro-6-cyano-4-ethyl-3-pyridinyl)-2-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-chloro-6-cyano-4-ethyl-3-pyridinyl)-2-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 123232359 |
| Molecular Formula | C19H27ClN4O2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | tert-butyl N-[1-(5-chloro-6-cyano-4-ethyl-3-pyridinyl)-2-methylpiperidin-3-yl]carbamate |
| SMILES | CCc1c(N2CCCC(NC(=O)OC(C)(C)C)C2C)cnc(C#N)c1Cl |
| InChI | InChI=1S/C19H27ClN4O2/c1-6-13-16(11-22-15(10-21)17(13)20)24-9-7-8-14(12(24)2)23-18(25)26-19(3,4)5/h11-12,14H,6-9H2,1-5H3,(H,23,25) |
| InChIKey | FJUBRSUPMCNUIH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |