C17H30O — CID 123239689
4-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-2,4-dien-1-ol (PubChem CID 123239689) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 4-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-2,4-dien-1-ol.
| Compound Name | 4-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 123239689 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 4-(2,2,5,5-tetramethylhexan-3-yl)cyclohepta-2,4-dien-1-ol |
| SMILES | CC(C)(C)CC(C1=CCCC(O)C=C1)C(C)(C)C |
| InChI | InChI=1S/C17H30O/c1-16(2,3)12-15(17(4,5)6)13-8-7-9-14(18)11-10-13/h8,10-11,14-15,18H,7,9,12H2,1-6H3 |
| InChIKey | JQHOCULALHLIEZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |