C13H21NO2 — CID 123241208
N-(3-hydroxybutan-2-yl)-2-prop-2-enylidenehex-3-enamide (PubChem CID 123241208) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(3-hydroxybutan-2-yl)-2-prop-2-enylidenehex-3-enamide.
| Compound Name | N-(3-hydroxybutan-2-yl)-2-prop-2-enylidenehex-3-enamide |
|---|---|
| PubChem CID | 123241208 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-(3-hydroxybutan-2-yl)-2-prop-2-enylidenehex-3-enamide |
| SMILES | C=CC=C(C=CCC)C(=O)NC(C)C(C)O |
| InChI | InChI=1S/C13H21NO2/c1-5-7-9-12(8-6-2)13(16)14-10(3)11(4)15/h6-11,15H,2,5H2,1,3-4H3,(H,14,16) |
| InChIKey | FJECYNPYWNFNHS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|