C23H24N6O2 — CID 123242028
N-[5-[2-ethoxy-5-(1-imino-3-methyliminopropan-2-yl)phenyl]pyrazin-2-yl]-4-methylpyridine-3-carboxamide (PubChem CID 123242028) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is N-[5-[2-ethoxy-5-(1-imino-3-methyliminopropan-2-yl)phenyl]pyrazin-2-yl]-4-methylpyridine-3-carboxamide.
| Compound Name | N-[5-[2-ethoxy-5-(1-imino-3-methyliminopropan-2-yl)phenyl]pyrazin-2-yl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 123242028 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[5-[2-ethoxy-5-(1-imino-3-methyliminopropan-2-yl)phenyl]pyrazin-2-yl]-4-methylpyridine-3-carboxamide |
| SMILES | [H]/N=C/C(/C=N/C)c1ccc(OCC)c(-c2cnc(NC(=O)c3cnccc3C)cn2)c1 |
| InChI | InChI=1S/C23H24N6O2/c1-4-31-21-6-5-16(17(10-24)11-25-3)9-18(21)20-13-28-22(14-27-20)29-23(30)19-12-26-8-7-15(19)2/h5-14,17,24H,4H2,1-3H3,(H,28,29,30)/b24-10+,25-11+ |
| InChIKey | CGQUVAVSZUAFJC-JTZQCBLNSA-N |
| XLogP | 3.93 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|