C24H25N5O3 — CID 89184659
N-[5-[5-[(3Z)-4-aminooxypenta-1,3-dien-2-yl]oxy-2-ethylphenyl]pyrazin-2-yl]-4-methylpyridine-3-carboxamide (PubChem CID 89184659) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is N-[5-[5-[(3Z)-4-aminooxypenta-1,3-dien-2-yl]oxy-2-ethylphenyl]pyrazin-2-yl]-4-methylpyridine-3-carboxamide.
| Compound Name | N-[5-[5-[(3Z)-4-aminooxypenta-1,3-dien-2-yl]oxy-2-ethylphenyl]pyrazin-2-yl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 89184659 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-[5-[5-[(3Z)-4-aminooxypenta-1,3-dien-2-yl]oxy-2-ethylphenyl]pyrazin-2-yl]-4-methylpyridine-3-carboxamide |
| SMILES | C=C(/C=C(/C)ON)Oc1ccc(CC)c(-c2cnc(NC(=O)c3cnccc3C)cn2)c1 |
| InChI | InChI=1S/C24H25N5O3/c1-5-18-6-7-19(31-16(3)10-17(4)32-25)11-20(18)22-13-28-23(14-27-22)29-24(30)21-12-26-9-8-15(21)2/h6-14H,3,5,25H2,1-2,4H3,(H,28,29,30)/b17-10- |
| InChIKey | MZYFVPGNPSELIR-YVLHZVERSA-N |
| XLogP | 4.35 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|