C18H32N4O5 — CID 123242774
2-formamido-5-methyl-N-[2-[[4-methyl-1-(3-methyloxaziridin-3-yl)-1-oxopentan-2-yl]amino]-2-oxoethyl]hexanamide (PubChem CID 123242774) has the molecular formula C18H32N4O5 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-formamido-5-methyl-N-[2-[[4-methyl-1-(3-methyloxaziridin-3-yl)-1-oxopentan-2-yl]amino]-2-oxoethyl]hexanamide.
| Compound Name | 2-formamido-5-methyl-N-[2-[[4-methyl-1-(3-methyloxaziridin-3-yl)-1-oxopentan-2-yl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 123242774 |
| Molecular Formula | C18H32N4O5 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 2-formamido-5-methyl-N-[2-[[4-methyl-1-(3-methyloxaziridin-3-yl)-1-oxopentan-2-yl]amino]-2-oxoethyl]hexanamide |
| SMILES | CC(C)CCC(NC=O)C(=O)NCC(=O)NC(CC(C)C)C(=O)C1(C)NO1 |
| InChI | InChI=1S/C18H32N4O5/c1-11(2)6-7-13(20-10-23)17(26)19-9-15(24)21-14(8-12(3)4)16(25)18(5)22-27-18/h10-14,22H,6-9H2,1-5H3,(H,19,26)(H,20,23)(H,21,24) |
| InChIKey | VSQGKHXERUZZIO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|