C39H37N9O4S — CID 123243946
N-[3-[6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide (PubChem CID 123243946) has the molecular formula C39H37N9O4S and a molecular weight of 727.85 g/mol. Its IUPAC name is N-[3-[6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide.
| Compound Name | N-[3-[6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 123243946 |
| Molecular Formula | C39H37N9O4S |
| Molecular Weight | 727.85 g/mol |
| Exact Mass | 727.27 |
| IUPAC Name | N-[3-[6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-cyano-3-[6-(4-methylpiperazin-1-yl)naphthalen-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCCNC(=O)C(C#N)=Cc2ccc4cc(N5CCN(C)CC5)ccc4c2)OCO3)o1 |
| InChI | InChI=1S/C39H37N9O4S/c1-24-4-9-31(52-24)30-19-32-33(51-23-50-32)20-34(30)53-39-45-35-36(41)43-22-44-37(35)48(39)11-3-10-42-38(49)28(21-40)17-25-5-6-27-18-29(8-7-26(27)16-25)47-14-12-46(2)13-15-47/h4-9,16-20,22H,3,10-15,23H2,1-2H3,(H,42,49)(H2,41,43,44) |
| InChIKey | YOXVJWZFDOGRPY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 160.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.85 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|