C21H22N7O5S2- — CID 67115470
6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-[2-(sulfinatoamino)ethylamino]ethyl]purine (PubChem CID 67115470) has the molecular formula C21H22N7O5S2- and a molecular weight of 516.59 g/mol. Its IUPAC name is 6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-[2-(sulfinatoamino)ethylamino]ethyl]purine.
| Compound Name | 6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-[2-(sulfinatoamino)ethylamino]ethyl]purine |
|---|---|
| PubChem CID | 67115470 |
| Molecular Formula | C21H22N7O5S2- |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-[2-(sulfinatoamino)ethylamino]ethyl]purine |
| SMILES | Cc1ccc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCNCCNS(=O)[O-])OCO3)o1 |
| InChI | InChI=1S/C21H23N7O5S2/c1-12-2-3-14(33-12)13-8-15-16(32-11-31-15)9-17(13)34-21-27-18-19(22)24-10-25-20(18)28(21)7-6-23-4-5-26-35(29)30/h2-3,8-10,23,26H,4-7,11H2,1H3,(H,29,30)(H2,22,24,25)/p-1 |
| InChIKey | VWNYJAFHRAEYDL-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|