C8H12Si — CID 123246215
3,4-dimethylpent-3-en-1-ynyl(methylidene)silane (PubChem CID 123246215) has the molecular formula C8H12Si and a molecular weight of 136.27 g/mol. Its IUPAC name is 3,4-dimethylpent-3-en-1-ynyl(methylidene)silane.
| Compound Name | 3,4-dimethylpent-3-en-1-ynyl(methylidene)silane |
|---|---|
| PubChem CID | 123246215 |
| Molecular Formula | C8H12Si |
| Molecular Weight | 136.27 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 3,4-dimethylpent-3-en-1-ynyl(methylidene)silane |
| SMILES | C=[SiH]C#CC(C)=C(C)C |
| InChI | InChI=1S/C8H12Si/c1-7(2)8(3)5-6-9-4/h9H,4H2,1-3H3 |
| InChIKey | XWJCYTOCGQLJJS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|