C22H28N8O3S2 — CID 123251970
N-[4-[4-[(1-amino-3-iminopropylidene)amino]-6-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-yl]sulfanylphenyl]cyclopropanecarboxamide (PubChem CID 123251970) has the molecular formula C22H28N8O3S2 and a molecular weight of 516.65 g/mol. Its IUPAC name is N-[4-[4-[(1-amino-3-iminopropylidene)amino]-6-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-yl]sulfanylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[4-[(1-amino-3-iminopropylidene)amino]-6-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 123251970 |
| Molecular Formula | C22H28N8O3S2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-[4-[4-[(1-amino-3-iminopropylidene)amino]-6-(4-methylsulfonylpiperazin-1-yl)pyrimidin-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
| SMILES | [H]/N=C/CC(N)=Nc1cc(N2CCN(S(C)(=O)=O)CC2)nc(Sc2ccc(NC(=O)C3CC3)cc2)n1 |
| InChI | InChI=1S/C22H28N8O3S2/c1-35(32,33)30-12-10-29(11-13-30)20-14-19(26-18(24)8-9-23)27-22(28-20)34-17-6-4-16(5-7-17)25-21(31)15-2-3-15/h4-7,9,14-15,23H,2-3,8,10-13H2,1H3,(H,25,31)(H2,24,26,27,28)/b23-9+ |
| InChIKey | PIAKBKGYKSXDBS-NUGSKGIGSA-N |
| XLogP | 2.09 |
| TPSA | 157.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|