C20H22F3N7OS — CID 171924204
N-[4-[4-(azetidin-1-yl)-6-[[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide (PubChem CID 171924204) has the molecular formula C20H22F3N7OS and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[4-[4-(azetidin-1-yl)-6-[[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[4-[4-(azetidin-1-yl)-6-[[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 171924204 |
| Molecular Formula | C20H22F3N7OS |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-[4-[4-(azetidin-1-yl)-6-[[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide |
| SMILES | C/C(N)=C/C(N)=Nc1cc(N2CCC2)nc(Sc2ccc(NC(=O)CC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H22F3N7OS/c1-12(24)9-15(25)27-16-10-17(30-7-2-8-30)29-19(28-16)32-14-5-3-13(4-6-14)26-18(31)11-20(21,22)23/h3-6,9-10H,2,7-8,11,24H2,1H3,(H,26,31)(H2,25,27,28,29)/b12-9- |
| InChIKey | BBCXPKOKHGKMQY-XFXZXTDPSA-N |
| XLogP | 3.58 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|