C21H23F4N7OS — CID 91297858
N-[4-[4-[(1-amino-3-iminobutylidene)amino]-6-(3-fluoropyrrolidin-1-yl)pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide (PubChem CID 91297858) has the molecular formula C21H23F4N7OS and a molecular weight of 497.52 g/mol. Its IUPAC name is N-[4-[4-[(1-amino-3-iminobutylidene)amino]-6-(3-fluoropyrrolidin-1-yl)pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[4-[4-[(1-amino-3-iminobutylidene)amino]-6-(3-fluoropyrrolidin-1-yl)pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 91297858 |
| Molecular Formula | C21H23F4N7OS |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[4-[4-[(1-amino-3-iminobutylidene)amino]-6-(3-fluoropyrrolidin-1-yl)pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide |
| SMILES | [H]/N=C(\C)CC(N)=Nc1cc(N2CCC(F)C2)nc(Sc2ccc(NC(=O)CC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C21H23F4N7OS/c1-12(26)8-16(27)29-17-9-18(32-7-6-13(22)11-32)31-20(30-17)34-15-4-2-14(3-5-15)28-19(33)10-21(23,24)25/h2-5,9,13,26H,6-8,10-11H2,1H3,(H,28,33)(H2,27,29,30,31)/b26-12+ |
| InChIKey | SDQUGVYMXGGEOK-RPPGKUMJSA-N |
| XLogP | 4.49 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|