C24H24ClN7O2S — CID 90799744
N-[4-[4-(azetidin-1-yl)-6-[(1,3-diamino-4-oxobutylidene)amino]pyrimidin-2-yl]sulfanylphenyl]-2-chlorobenzamide (PubChem CID 90799744) has the molecular formula C24H24ClN7O2S and a molecular weight of 510.02 g/mol. Its IUPAC name is N-[4-[4-(azetidin-1-yl)-6-[(1,3-diamino-4-oxobutylidene)amino]pyrimidin-2-yl]sulfanylphenyl]-2-chlorobenzamide.
| Compound Name | N-[4-[4-(azetidin-1-yl)-6-[(1,3-diamino-4-oxobutylidene)amino]pyrimidin-2-yl]sulfanylphenyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 90799744 |
| Molecular Formula | C24H24ClN7O2S |
| Molecular Weight | 510.02 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[4-[4-(azetidin-1-yl)-6-[(1,3-diamino-4-oxobutylidene)amino]pyrimidin-2-yl]sulfanylphenyl]-2-chlorobenzamide |
| SMILES | NC(CC(N)C=O)=Nc1cc(N2CCC2)nc(Sc2ccc(NC(=O)c3ccccc3Cl)cc2)n1 |
| InChI | InChI=1S/C24H24ClN7O2S/c25-19-5-2-1-4-18(19)23(34)28-16-6-8-17(9-7-16)35-24-30-21(29-20(27)12-15(26)14-33)13-22(31-24)32-10-3-11-32/h1-2,4-9,13-15H,3,10-12,26H2,(H,28,34)(H2,27,29,30,31) |
| InChIKey | VFBVTJZGQHKMPI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.02 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|