C14H24O4Si2 — CID 123253978
2-hydroxy-2-methyl-1-[4-[methyl(trimethylsilyloxy)silyl]oxyphenyl]propan-1-one (PubChem CID 123253978) has the molecular formula C14H24O4Si2 and a molecular weight of 312.51 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-1-[4-[methyl(trimethylsilyloxy)silyl]oxyphenyl]propan-1-one.
| Compound Name | 2-hydroxy-2-methyl-1-[4-[methyl(trimethylsilyloxy)silyl]oxyphenyl]propan-1-one |
|---|---|
| PubChem CID | 123253978 |
| Molecular Formula | C14H24O4Si2 |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-hydroxy-2-methyl-1-[4-[methyl(trimethylsilyloxy)silyl]oxyphenyl]propan-1-one |
| SMILES | C[SiH](Oc1ccc(C(=O)C(C)(C)O)cc1)O[Si](C)(C)C |
| InChI | InChI=1S/C14H24O4Si2/c1-14(2,16)13(15)11-7-9-12(10-8-11)17-19(3)18-20(4,5)6/h7-10,16,19H,1-6H3 |
| InChIKey | VVTATQFFKQBJNY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|