C25H30N2O6 — CID 123256305
tert-butyl N-[[3-[[4-(methoxymethoxymethyl)-1,3-oxazol-2-yl]methoxy]phenyl]-phenylmethyl]carbamate (PubChem CID 123256305) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is tert-butyl N-[[3-[[4-(methoxymethoxymethyl)-1,3-oxazol-2-yl]methoxy]phenyl]-phenylmethyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[4-(methoxymethoxymethyl)-1,3-oxazol-2-yl]methoxy]phenyl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 123256305 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | tert-butyl N-[[3-[[4-(methoxymethoxymethyl)-1,3-oxazol-2-yl]methoxy]phenyl]-phenylmethyl]carbamate |
| SMILES | COCOCc1coc(COc2cccc(C(NC(=O)OC(C)(C)C)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C25H30N2O6/c1-25(2,3)33-24(28)27-23(18-9-6-5-7-10-18)19-11-8-12-21(13-19)31-16-22-26-20(15-32-22)14-30-17-29-4/h5-13,15,23H,14,16-17H2,1-4H3,(H,27,28) |
| InChIKey | HRQIBLPBSDAYHU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|