C12H28O3Si3 — CID 123257515
3-[dimethyl(silyloxysilyl)silyl]-3-methyl-2-propan-2-ylidenehexanoic acid (PubChem CID 123257515) has the molecular formula C12H28O3Si3 and a molecular weight of 304.61 g/mol. Its IUPAC name is 3-[dimethyl(silyloxysilyl)silyl]-3-methyl-2-propan-2-ylidenehexanoic acid.
| Compound Name | 3-[dimethyl(silyloxysilyl)silyl]-3-methyl-2-propan-2-ylidenehexanoic acid |
|---|---|
| PubChem CID | 123257515 |
| Molecular Formula | C12H28O3Si3 |
| Molecular Weight | 304.61 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-[dimethyl(silyloxysilyl)silyl]-3-methyl-2-propan-2-ylidenehexanoic acid |
| SMILES | CCCC(C)(C(C(=O)O)=C(C)C)[Si](C)(C)[SiH2]O[SiH3] |
| InChI | InChI=1S/C12H28O3Si3/c1-7-8-12(4,18(5,6)17-15-16)10(9(2)3)11(13)14/h7-8,17H2,1-6,16H3,(H,13,14) |
| InChIKey | UXQTUABXIZUAHS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.61 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|