C25H24FN3O4 — CID 123259267
5-[2-[(3R,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-oxoethyl]-3H-2-benzofuran-1-one (PubChem CID 123259267) has the molecular formula C25H24FN3O4 and a molecular weight of 449.48 g/mol. Its IUPAC name is 5-[2-[(3R,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-oxoethyl]-3H-2-benzofuran-1-one.
| Compound Name | 5-[2-[(3R,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-oxoethyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 123259267 |
| Molecular Formula | C25H24FN3O4 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 5-[2-[(3R,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-oxoethyl]-3H-2-benzofuran-1-one |
| SMILES | [C-]#[N+]c1c(F)ccc([C@@H]2CN3CCN(C(=O)Cc4ccc5c(c4)COC5=O)C[C@H]3CO2)c1C |
| InChI | InChI=1S/C25H24FN3O4/c1-15-19(5-6-21(26)24(15)27-2)22-12-28-7-8-29(11-18(28)14-32-22)23(30)10-16-3-4-20-17(9-16)13-33-25(20)31/h3-6,9,18,22H,7-8,10-14H2,1H3/t18-,22-/m0/s1 |
| InChIKey | LBOFZHSIXQECSM-AVRDEDQJSA-N |
| XLogP | 3.18 |
| TPSA | 63.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|