C24H25FN8O2 — CID 122197825
1-[(3S,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[6-methyl-5-(tetrazol-1-yl)-2-pyridinyl]ethanone (PubChem CID 122197825) has the molecular formula C24H25FN8O2 and a molecular weight of 476.52 g/mol. Its IUPAC name is 1-[(3S,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[6-methyl-5-(tetrazol-1-yl)-2-pyridinyl]ethanone.
| Compound Name | 1-[(3S,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[6-methyl-5-(tetrazol-1-yl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 122197825 |
| Molecular Formula | C24H25FN8O2 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-[(3S,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[6-methyl-5-(tetrazol-1-yl)-2-pyridinyl]ethanone |
| SMILES | [C-]#[N+]c1c(F)ccc([C@H]2CN3CCN(C(=O)Cc4ccc(-n5cnnn5)c(C)n4)C[C@H]3CO2)c1C |
| InChI | InChI=1S/C24H25FN8O2/c1-15-19(5-6-20(25)24(15)26-3)22-12-31-8-9-32(11-18(31)13-35-22)23(34)10-17-4-7-21(16(2)28-17)33-14-27-29-30-33/h4-7,14,18,22H,8-13H2,1-2H3/t18-,22+/m0/s1 |
| InChIKey | ZXOIWMOTJGPNGM-PGRDOPGGSA-N |
| XLogP | 2.19 |
| TPSA | 93.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|