C24H22F3N7O2 — CID 123730840
1-[(3R,9aR)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2,5-difluoro-4-(tetrazol-1-yl)phenyl]ethanone (PubChem CID 123730840) has the molecular formula C24H22F3N7O2 and a molecular weight of 497.48 g/mol. Its IUPAC name is 1-[(3R,9aR)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2,5-difluoro-4-(tetrazol-1-yl)phenyl]ethanone.
| Compound Name | 1-[(3R,9aR)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2,5-difluoro-4-(tetrazol-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 123730840 |
| Molecular Formula | C24H22F3N7O2 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-[(3R,9aR)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2,5-difluoro-4-(tetrazol-1-yl)phenyl]ethanone |
| SMILES | [C-]#[N+]c1c(F)ccc([C@@H]2CN3CCN(C(=O)Cc4cc(F)c(-n5cnnn5)cc4F)C[C@@H]3CO2)c1C |
| InChI | InChI=1S/C24H22F3N7O2/c1-14-17(3-4-18(25)24(14)28-2)22-11-32-5-6-33(10-16(32)12-36-22)23(35)8-15-7-20(27)21(9-19(15)26)34-13-29-30-31-34/h3-4,7,9,13,16,22H,5-6,8,10-12H2,1H3/t16-,22+/m1/s1 |
| InChIKey | DQHGGIBBXZUPGD-ZHRRBRCNSA-N |
| XLogP | 2.77 |
| TPSA | 80.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|