C22H22FN9O2 — CID 153077215
1-[(3R,9aS)-3-(2-fluoro-5-isocyano-4-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone (PubChem CID 153077215) has the molecular formula C22H22FN9O2 and a molecular weight of 463.48 g/mol. Its IUPAC name is 1-[(3R,9aS)-3-(2-fluoro-5-isocyano-4-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(3R,9aS)-3-(2-fluoro-5-isocyano-4-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 153077215 |
| Molecular Formula | C22H22FN9O2 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1-[(3R,9aS)-3-(2-fluoro-5-isocyano-4-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone |
| SMILES | [C-]#[N+]c1cc([C@@H]2CN3CCN(C(=O)Cc4cnc(-n5cnnn5)nc4)C[C@H]3CO2)c(F)cc1C |
| InChI | InChI=1S/C22H22FN9O2/c1-14-5-18(23)17(7-19(14)24-2)20-11-30-3-4-31(10-16(30)12-34-20)21(33)6-15-8-25-22(26-9-15)32-13-27-28-29-32/h5,7-9,13,16,20H,3-4,6,10-12H2,1H3/t16-,20-/m0/s1 |
| InChIKey | VMNYPJMMDCKWCC-JXFKEZNVSA-N |
| XLogP | 1.28 |
| TPSA | 106.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|