C21H19F2N9O2 — CID 122197815
1-[(3R,9aR)-3-(3,5-difluoro-4-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone (PubChem CID 122197815) has the molecular formula C21H19F2N9O2 and a molecular weight of 467.44 g/mol. Its IUPAC name is 1-[(3R,9aR)-3-(3,5-difluoro-4-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(3R,9aR)-3-(3,5-difluoro-4-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 122197815 |
| Molecular Formula | C21H19F2N9O2 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-[(3R,9aR)-3-(3,5-difluoro-4-isocyanophenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone |
| SMILES | [C-]#[N+]c1c(F)cc([C@@H]2CN3CCN(C(=O)Cc4cnc(-n5cnnn5)nc4)C[C@@H]3CO2)cc1F |
| InChI | InChI=1S/C21H19F2N9O2/c1-24-20-16(22)5-14(6-17(20)23)18-10-30-2-3-31(9-15(30)11-34-18)19(33)4-13-7-25-21(26-8-13)32-12-27-28-29-32/h5-8,12,15,18H,2-4,9-11H2/t15-,18+/m1/s1 |
| InChIKey | RVZNAUJSKDJIQY-QAPCUYQASA-N |
| XLogP | 1.11 |
| TPSA | 106.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|