C23H22F2N8O2 — CID 122197846
1-[(3S,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[5-fluoro-6-(tetrazol-1-yl)-3-pyridinyl]ethanone (PubChem CID 122197846) has the molecular formula C23H22F2N8O2 and a molecular weight of 480.48 g/mol. Its IUPAC name is 1-[(3S,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[5-fluoro-6-(tetrazol-1-yl)-3-pyridinyl]ethanone.
| Compound Name | 1-[(3S,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[5-fluoro-6-(tetrazol-1-yl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 122197846 |
| Molecular Formula | C23H22F2N8O2 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1-[(3S,9aS)-3-(4-fluoro-3-isocyano-2-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[5-fluoro-6-(tetrazol-1-yl)-3-pyridinyl]ethanone |
| SMILES | [C-]#[N+]c1c(F)ccc([C@H]2CN3CCN(C(=O)Cc4cnc(-n5cnnn5)c(F)c4)C[C@H]3CO2)c1C |
| InChI | InChI=1S/C23H22F2N8O2/c1-14-17(3-4-18(24)22(14)26-2)20-11-31-5-6-32(10-16(31)12-35-20)21(34)8-15-7-19(25)23(27-9-15)33-13-28-29-30-33/h3-4,7,9,13,16,20H,5-6,8,10-12H2,1H3/t16-,20+/m0/s1 |
| InChIKey | QRDHTEJMUGASER-OXJNMPFZSA-N |
| XLogP | 2.02 |
| TPSA | 93.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|