C22H22FN9O3 — CID 122197838
1-[(3R,9aS)-3-(4-fluoro-3-isocyano-2-methoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone (PubChem CID 122197838) has the molecular formula C22H22FN9O3 and a molecular weight of 479.48 g/mol. Its IUPAC name is 1-[(3R,9aS)-3-(4-fluoro-3-isocyano-2-methoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(3R,9aS)-3-(4-fluoro-3-isocyano-2-methoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 122197838 |
| Molecular Formula | C22H22FN9O3 |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 1-[(3R,9aS)-3-(4-fluoro-3-isocyano-2-methoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[2-(tetrazol-1-yl)pyrimidin-5-yl]ethanone |
| SMILES | [C-]#[N+]c1c(F)ccc([C@@H]2CN3CCN(C(=O)Cc4cnc(-n5cnnn5)nc4)C[C@H]3CO2)c1OC |
| InChI | InChI=1S/C22H22FN9O3/c1-24-20-17(23)4-3-16(21(20)34-2)18-11-30-5-6-31(10-15(30)12-35-18)19(33)7-14-8-25-22(26-9-14)32-13-27-28-29-32/h3-4,8-9,13,15,18H,5-7,10-12H2,2H3/t15-,18-/m0/s1 |
| InChIKey | UHALRHUVPCEALV-YJBOKZPZSA-N |
| XLogP | 0.98 |
| TPSA | 115.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|