C21H22N8O2S — CID 122197778
1-[(3R,9aS)-3-(5-isocyano-4-methylthiophen-3-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[5-(tetrazol-1-yl)-2-pyridinyl]ethanone (PubChem CID 122197778) has the molecular formula C21H22N8O2S and a molecular weight of 450.53 g/mol. Its IUPAC name is 1-[(3R,9aS)-3-(5-isocyano-4-methylthiophen-3-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[5-(tetrazol-1-yl)-2-pyridinyl]ethanone.
| Compound Name | 1-[(3R,9aS)-3-(5-isocyano-4-methylthiophen-3-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[5-(tetrazol-1-yl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 122197778 |
| Molecular Formula | C21H22N8O2S |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 1-[(3R,9aS)-3-(5-isocyano-4-methylthiophen-3-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-[5-(tetrazol-1-yl)-2-pyridinyl]ethanone |
| SMILES | [C-]#[N+]c1scc([C@@H]2CN3CCN(C(=O)Cc4ccc(-n5cnnn5)cn4)C[C@H]3CO2)c1C |
| InChI | InChI=1S/C21H22N8O2S/c1-14-18(12-32-21(14)22-2)19-10-27-5-6-28(9-17(27)11-31-19)20(30)7-15-3-4-16(8-23-15)29-13-24-25-26-29/h3-4,8,12-13,17,19H,5-7,9-11H2,1H3/t17-,19-/m0/s1 |
| InChIKey | NNOQFAQPTXLMRT-HKUYNNGSSA-N |
| XLogP | 1.80 |
| TPSA | 93.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|