C20H38N2O6 — CID 123259415
5-ethenyl-4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane (PubChem CID 123259415) has the molecular formula C20H38N2O6 and a molecular weight of 402.53 g/mol. Its IUPAC name is 5-ethenyl-4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane.
| Compound Name | 5-ethenyl-4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane |
|---|---|
| PubChem CID | 123259415 |
| Molecular Formula | C20H38N2O6 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 5-ethenyl-4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane |
| SMILES | C=CC1COCCN2CCOCCOCCN(CCOCCOCC2)CCO1 |
| InChI | InChI=1S/C20H38N2O6/c1-2-20-19-27-13-7-21-3-9-23-15-17-25-11-5-22(8-14-28-20)6-12-26-18-16-24-10-4-21/h2,20H,1,3-19H2 |
| InChIKey | CVXCDZQRVNGMSK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 61.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|