C36H43N4O6+ — CID 123262059
2-[[3,3-dimethyl-1-(3-methylbutyl)-4-nitroindol-1-ium-2-yl]methylidene]-4-[[3,3-dimethyl-1-(3-methylbutyl)-4-nitro-2H-indol-2-yl]methylidene]cyclobutane-1,3-dione (PubChem CID 123262059) has the molecular formula C36H43N4O6+ and a molecular weight of 627.76 g/mol. Its IUPAC name is 2-[[3,3-dimethyl-1-(3-methylbutyl)-4-nitroindol-1-ium-2-yl]methylidene]-4-[[3,3-dimethyl-1-(3-methylbutyl)-4-nitro-2H-indol-2-yl]methylidene]cyclobutane-1,3-dione.
| Compound Name | 2-[[3,3-dimethyl-1-(3-methylbutyl)-4-nitroindol-1-ium-2-yl]methylidene]-4-[[3,3-dimethyl-1-(3-methylbutyl)-4-nitro-2H-indol-2-yl]methylidene]cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 123262059 |
| Molecular Formula | C36H43N4O6+ |
| Molecular Weight | 627.76 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | 2-[[3,3-dimethyl-1-(3-methylbutyl)-4-nitroindol-1-ium-2-yl]methylidene]-4-[[3,3-dimethyl-1-(3-methylbutyl)-4-nitro-2H-indol-2-yl]methylidene]cyclobutane-1,3-dione |
| SMILES | CC(C)CCN1c2cccc([N+](=O)[O-])c2C(C)(C)C1C=c1c(=O)c(=CC2=[N+](CCC(C)C)c3cccc([N+](=O)[O-])c3C2(C)C)c1=O |
| InChI | InChI=1S/C36H43N4O6/c1-21(2)15-17-37-25-11-9-13-27(39(43)44)31(25)35(5,6)29(37)19-23-33(41)24(34(23)42)20-30-36(7,8)32-26(38(30)18-16-22(3)4)12-10-14-28(32)40(45)46/h9-14,19-22,29H,15-18H2,1-8H3/q+1/b23-19-,24-20+ |
| InChIKey | JADYAKKHHNKSBV-KDMDJZHMSA-N |
| XLogP | 4.99 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.76 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|