C12H16FN2O+ — CID 123264707
3-(5-fluoro-4-methylocta-1,3,5-trien-2-yl)-4-methyl-1,2,4-oxadiazol-4-ium (PubChem CID 123264707) has the molecular formula C12H16FN2O+ and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(5-fluoro-4-methylocta-1,3,5-trien-2-yl)-4-methyl-1,2,4-oxadiazol-4-ium.
| Compound Name | 3-(5-fluoro-4-methylocta-1,3,5-trien-2-yl)-4-methyl-1,2,4-oxadiazol-4-ium |
|---|---|
| PubChem CID | 123264707 |
| Molecular Formula | C12H16FN2O+ |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(5-fluoro-4-methylocta-1,3,5-trien-2-yl)-4-methyl-1,2,4-oxadiazol-4-ium |
| SMILES | C=C(C=C(C)C(F)=CCC)c1noc[n+]1C |
| InChI | InChI=1S/C12H16FN2O/c1-5-6-11(13)9(2)7-10(3)12-14-16-8-15(12)4/h6-8H,3,5H2,1-2,4H3/q+1 |
| InChIKey | PXDLUDUGYCULAL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|