C23H30F6O4 — CID 123274269
[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2-[4-(2,5,5-trimethylhexan-3-yl)phenyl]propanoate (PubChem CID 123274269) has the molecular formula C23H30F6O4 and a molecular weight of 484.48 g/mol. Its IUPAC name is [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2-[4-(2,5,5-trimethylhexan-3-yl)phenyl]propanoate.
| Compound Name | [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2-[4-(2,5,5-trimethylhexan-3-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 123274269 |
| Molecular Formula | C23H30F6O4 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 2-[4-(2,5,5-trimethylhexan-3-yl)phenyl]propanoate |
| SMILES | CC(C(=O)OCC(=O)OC(C(F)(F)F)C(F)(F)F)c1ccc(C(CC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H30F6O4/c1-13(2)17(11-21(4,5)6)16-9-7-15(8-10-16)14(3)19(31)32-12-18(30)33-20(22(24,25)26)23(27,28)29/h7-10,13-14,17,20H,11-12H2,1-6H3 |
| InChIKey | VEQIZTLLWHANRX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |