C5H2F6N2S — CID 123274784
3,5-bis(trifluoromethyl)-1H-pyrazole-4-thiol (PubChem CID 123274784) has the molecular formula C5H2F6N2S and a molecular weight of 236.14 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-1H-pyrazole-4-thiol.
| Compound Name | 3,5-bis(trifluoromethyl)-1H-pyrazole-4-thiol |
|---|---|
| PubChem CID | 123274784 |
| Molecular Formula | C5H2F6N2S |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-1H-pyrazole-4-thiol |
| SMILES | FC(F)(F)c1n[nH]c(C(F)(F)F)c1S |
| InChI | InChI=1S/C5H2F6N2S/c6-4(7,8)2-1(14)3(13-12-2)5(9,10)11/h14H,(H,12,13) |
| InChIKey | HGYWQTFDLVHNFG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|