C8H3F9N2O4 — CID 13245511
oxalic acid;3,4,5-tris(trifluoromethyl)-1H-pyrazole (PubChem CID 13245511) has the molecular formula C8H3F9N2O4 and a molecular weight of 362.10 g/mol. Its IUPAC name is oxalic acid;3,4,5-tris(trifluoromethyl)-1H-pyrazole.
| Compound Name | oxalic acid;3,4,5-tris(trifluoromethyl)-1H-pyrazole |
|---|---|
| PubChem CID | 13245511 |
| Molecular Formula | C8H3F9N2O4 |
| Molecular Weight | 362.10 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | oxalic acid;3,4,5-tris(trifluoromethyl)-1H-pyrazole |
| SMILES | FC(F)(F)c1n[nH]c(C(F)(F)F)c1C(F)(F)F.O=C(O)C(=O)O |
| InChI | InChI=1S/C6HF9N2.C2H2O4/c7-4(8,9)1-2(5(10,11)12)16-17-3(1)6(13,14)15;3-1(4)2(5)6/h(H,16,17);(H,3,4)(H,5,6) |
| InChIKey | WSUHUSGNGSFFMU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.10 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|