C8F12N2 — CID 12633182
3,4,5,6-tetrakis(trifluoromethyl)pyridazine (PubChem CID 12633182) has the molecular formula C8F12N2 and a molecular weight of 352.08 g/mol. Its IUPAC name is 3,4,5,6-tetrakis(trifluoromethyl)pyridazine.
| Compound Name | 3,4,5,6-tetrakis(trifluoromethyl)pyridazine |
|---|---|
| PubChem CID | 12633182 |
| Molecular Formula | C8F12N2 |
| Molecular Weight | 352.08 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 3,4,5,6-tetrakis(trifluoromethyl)pyridazine |
| SMILES | FC(F)(F)c1nnc(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C8F12N2/c9-5(10,11)1-2(6(12,13)14)4(8(18,19)20)22-21-3(1)7(15,16)17 |
| InChIKey | YSNPTUYOZUOODQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.08 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |