About CID 165399456
CID 165399456 (PubChem CID 165399456) has the molecular formula C8H9AsF3N2
and a molecular weight of 265.09 g/mol.
Molecular Properties
| Compound Name | CID 165399456 |
| PubChem CID | 165399456 |
| Molecular Formula | C8H9AsF3N2 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | — |
| SMILES | C[As]c1c(C)nnc(C)c1C(F)(F)F |
| InChI | InChI=1S/C8H9AsF3N2/c1-4-6(8(10,11)12)7(9-3)5(2)14-13-4/h1-3H3 |
| InChIKey | CEFDPAUZDVMOCZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 165399456 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165399456?
The IUPAC name of CID 165399456 (CID 165399456) is not available.
What is the SMILES notation for CID 165399456?
The canonical SMILES for CID 165399456 is C[As]c1c(C)nnc(C)c1C(F)(F)F.
What is the InChIKey of CID 165399456?
The InChIKey is CEFDPAUZDVMOCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9AsF3N2/c1-4-6(8(10,11)12)7(9-3)5(2)14-13-4/h1-3H3.
What are the key properties of CID 165399456?
CID 165399456 has a molecular weight of 265.09 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165399456 is sourced from PubChem (CID 165399456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).