C9H11F3N2 — CID 176974728
3,4,6-trimethyl-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 176974728) has the molecular formula C9H11F3N2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 3,4,6-trimethyl-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3,4,6-trimethyl-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 176974728 |
| Molecular Formula | C9H11F3N2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3,4,6-trimethyl-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1nc(N)c(C)c(C)c1C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2/c1-4-5(2)8(13)14-6(3)7(4)9(10,11)12/h1-3H3,(H2,13,14) |
| InChIKey | QWQKJMGDFULVHM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |