About CID 162597724
CID 162597724 (PubChem CID 162597724) has the molecular formula C7H6BF3N2S
and a molecular weight of 218.01 g/mol.
Molecular Properties
| Compound Name | CID 162597724 |
| PubChem CID | 162597724 |
| Molecular Formula | C7H6BF3N2S |
| Molecular Weight | 218.01 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | — |
| SMILES | [B]c1c(N)nc(C(F)(F)F)c(S)c1C |
| InChI | InChI=1S/C7H6BF3N2S/c1-2-3(8)6(12)13-5(4(2)14)7(9,10)11/h14H,1H3,(H2,12,13) |
| InChIKey | HFFZPSVSPVYQQT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.01 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 162597724 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162597724?
The IUPAC name of CID 162597724 (CID 162597724) is not available.
What is the SMILES notation for CID 162597724?
The canonical SMILES for CID 162597724 is [B]c1c(N)nc(C(F)(F)F)c(S)c1C.
What is the InChIKey of CID 162597724?
The InChIKey is HFFZPSVSPVYQQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BF3N2S/c1-2-3(8)6(12)13-5(4(2)14)7(9,10)11/h14H,1H3,(H2,12,13).
What are the key properties of CID 162597724?
CID 162597724 has a molecular weight of 218.01 g/mol, XLogP of 1.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162597724 is sourced from PubChem (CID 162597724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).