C11F15I — CID 146814181
1-iodo-2,3,4,5,6-pentakis(trifluoromethyl)benzene (PubChem CID 146814181) has the molecular formula C11F15I and a molecular weight of 544.00 g/mol. Its IUPAC name is 1-iodo-2,3,4,5,6-pentakis(trifluoromethyl)benzene.
| Compound Name | 1-iodo-2,3,4,5,6-pentakis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 146814181 |
| Molecular Formula | C11F15I |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.88 |
| IUPAC Name | 1-iodo-2,3,4,5,6-pentakis(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1c(I)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C11F15I/c12-7(13,14)1-2(8(15,16)17)4(10(21,22)23)6(27)5(11(24,25)26)3(1)9(18,19)20 |
| InChIKey | SATIWVOUSRFDJJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|