C13H7F15OSi — CID 153323664
hydroxy-dimethyl-[2,3,4,5,6-pentakis(trifluoromethyl)phenyl]silane (PubChem CID 153323664) has the molecular formula C13H7F15OSi and a molecular weight of 492.25 g/mol. Its IUPAC name is hydroxy-dimethyl-[2,3,4,5,6-pentakis(trifluoromethyl)phenyl]silane.
| Compound Name | hydroxy-dimethyl-[2,3,4,5,6-pentakis(trifluoromethyl)phenyl]silane |
|---|---|
| PubChem CID | 153323664 |
| Molecular Formula | C13H7F15OSi |
| Molecular Weight | 492.25 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | hydroxy-dimethyl-[2,3,4,5,6-pentakis(trifluoromethyl)phenyl]silane |
| SMILES | C[Si](C)(O)c1c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C13H7F15OSi/c1-30(2,29)8-6(12(23,24)25)4(10(17,18)19)3(9(14,15)16)5(11(20,21)22)7(8)13(26,27)28/h29H,1-2H3 |
| InChIKey | KQUCRJBCLFDDOZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.25 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|