C8H7B2F3N2O5 — CID 71242228
[4-borono-6-methyl-5-(trifluoromethyl)-2,1,3-benzoxadiazol-7-yl]boronic acid (PubChem CID 71242228) has the molecular formula C8H7B2F3N2O5 and a molecular weight of 289.77 g/mol. Its IUPAC name is [4-borono-6-methyl-5-(trifluoromethyl)-2,1,3-benzoxadiazol-7-yl]boronic acid.
| Compound Name | [4-borono-6-methyl-5-(trifluoromethyl)-2,1,3-benzoxadiazol-7-yl]boronic acid |
|---|---|
| PubChem CID | 71242228 |
| Molecular Formula | C8H7B2F3N2O5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [4-borono-6-methyl-5-(trifluoromethyl)-2,1,3-benzoxadiazol-7-yl]boronic acid |
| SMILES | Cc1c(C(F)(F)F)c(B(O)O)c2nonc2c1B(O)O |
| InChI | InChI=1S/C8H7B2F3N2O5/c1-2-3(8(11,12)13)5(10(18)19)7-6(14-20-15-7)4(2)9(16)17/h16-19H,1H3 |
| InChIKey | RONGLQGVWZNJGI-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|