C6H2F6N2O — CID 155905780
3,5-bis(trifluoromethyl)-1H-pyrazole-4-carbaldehyde (PubChem CID 155905780) has the molecular formula C6H2F6N2O and a molecular weight of 232.08 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-1H-pyrazole-4-carbaldehyde.
| Compound Name | 3,5-bis(trifluoromethyl)-1H-pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 155905780 |
| Molecular Formula | C6H2F6N2O |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-1H-pyrazole-4-carbaldehyde |
| SMILES | O=Cc1c(C(F)(F)F)n[nH]c1C(F)(F)F |
| InChI | InChI=1S/C6H2F6N2O/c7-5(8,9)3-2(1-15)4(14-13-3)6(10,11)12/h1H,(H,13,14) |
| InChIKey | YIENMMSZRTUTBI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|