C17H27N3O4S — CID 123278315
3-(butylamino)-4-(1-pyrrolidin-1-ylethyl)-5-sulfamoylbenzoic acid (PubChem CID 123278315) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-(butylamino)-4-(1-pyrrolidin-1-ylethyl)-5-sulfamoylbenzoic acid.
| Compound Name | 3-(butylamino)-4-(1-pyrrolidin-1-ylethyl)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 123278315 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-(butylamino)-4-(1-pyrrolidin-1-ylethyl)-5-sulfamoylbenzoic acid |
| SMILES | CCCCNc1cc(C(=O)O)cc(S(N)(=O)=O)c1C(C)N1CCCC1 |
| InChI | InChI=1S/C17H27N3O4S/c1-3-4-7-19-14-10-13(17(21)22)11-15(25(18,23)24)16(14)12(2)20-8-5-6-9-20/h10-12,19H,3-9H2,1-2H3,(H,21,22)(H2,18,23,24) |
| InChIKey | QENZJXDIIFALQX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|