C11H21N — CID 123279430
N,N,2,6-tetramethylhepta-2,4-dien-4-amine (PubChem CID 123279430) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is N,N,2,6-tetramethylhepta-2,4-dien-4-amine.
| Compound Name | N,N,2,6-tetramethylhepta-2,4-dien-4-amine |
|---|---|
| PubChem CID | 123279430 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N,N,2,6-tetramethylhepta-2,4-dien-4-amine |
| SMILES | CC(C)=CC(=CC(C)C)N(C)C |
| InChI | InChI=1S/C11H21N/c1-9(2)7-11(12(5)6)8-10(3)4/h7-9H,1-6H3 |
| InChIKey | GFQQDSGULHGPJN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|