C17H22O2 — CID 123282450
(4-ethylidene-1,3-dimethoxyhepta-1,5-dienyl)benzene (PubChem CID 123282450) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (4-ethylidene-1,3-dimethoxyhepta-1,5-dienyl)benzene.
| Compound Name | (4-ethylidene-1,3-dimethoxyhepta-1,5-dienyl)benzene |
|---|---|
| PubChem CID | 123282450 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (4-ethylidene-1,3-dimethoxyhepta-1,5-dienyl)benzene |
| SMILES | CC=CC(=CC)C(C=C(OC)c1ccccc1)OC |
| InChI | InChI=1S/C17H22O2/c1-5-10-14(6-2)16(18-3)13-17(19-4)15-11-8-7-9-12-15/h5-13,16H,1-4H3 |
| InChIKey | HNRYLAKSXOMXQI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|