C18H37N — CID 123283209
N,3,6,9-tetramethyl-5-propylundec-7-en-1-amine (PubChem CID 123283209) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is N,3,6,9-tetramethyl-5-propylundec-7-en-1-amine.
| Compound Name | N,3,6,9-tetramethyl-5-propylundec-7-en-1-amine |
|---|---|
| PubChem CID | 123283209 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | N,3,6,9-tetramethyl-5-propylundec-7-en-1-amine |
| SMILES | CCCC(CC(C)CCNC)C(C)C=CC(C)CC |
| InChI | InChI=1S/C18H37N/c1-7-9-18(14-16(4)12-13-19-6)17(5)11-10-15(3)8-2/h10-11,15-19H,7-9,12-14H2,1-6H3 |
| InChIKey | XYUNLGPHAQXUEF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|