C9H18N2O5 — CID 123284445
(2R,3R,5S)-5,7-diamino-1,2,3,6-tetrahydroxynon-8-en-4-one (PubChem CID 123284445) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is (2R,3R,5S)-5,7-diamino-1,2,3,6-tetrahydroxynon-8-en-4-one.
| Compound Name | (2R,3R,5S)-5,7-diamino-1,2,3,6-tetrahydroxynon-8-en-4-one |
|---|---|
| PubChem CID | 123284445 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (2R,3R,5S)-5,7-diamino-1,2,3,6-tetrahydroxynon-8-en-4-one |
| SMILES | C=CC(N)C(O)[C@H](N)C(=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18N2O5/c1-2-4(10)7(14)6(11)9(16)8(15)5(13)3-12/h2,4-8,12-15H,1,3,10-11H2/t4?,5-,6+,7?,8-/m1/s1 |
| InChIKey | WDKNSMPFAXZXCF-ZMFZBRJOSA-N |
| XLogP | -3.53 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|