C33H51NO4Si — CID 123285187
tert-butyl 4-[(5R)-5-[tert-butyl(diphenyl)silyl]oxyhexoxy]-4-methylpiperidine-1-carboxylate (PubChem CID 123285187) has the molecular formula C33H51NO4Si and a molecular weight of 553.86 g/mol. Its IUPAC name is tert-butyl 4-[(5R)-5-[tert-butyl(diphenyl)silyl]oxyhexoxy]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5R)-5-[tert-butyl(diphenyl)silyl]oxyhexoxy]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123285187 |
| Molecular Formula | C33H51NO4Si |
| Molecular Weight | 553.86 g/mol |
| Exact Mass | 553.36 |
| IUPAC Name | tert-butyl 4-[(5R)-5-[tert-butyl(diphenyl)silyl]oxyhexoxy]-4-methylpiperidine-1-carboxylate |
| SMILES | C[C@H](CCCCOC1(C)CCN(C(=O)OC(C)(C)C)CC1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H51NO4Si/c1-27(17-15-16-26-36-33(8)22-24-34(25-23-33)30(35)37-31(2,3)4)38-39(32(5,6)7,28-18-11-9-12-19-28)29-20-13-10-14-21-29/h9-14,18-21,27H,15-17,22-26H2,1-8H3/t27-/m1/s1 |
| InChIKey | BSRMKVBBVNIEDF-HHHXNRCGSA-N |
| XLogP | 6.93 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.86 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|