C10H18F3NO2 — CID 123293491
N,4-dimethylcyclohexan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 123293491) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is N,4-dimethylcyclohexan-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N,4-dimethylcyclohexan-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 123293491 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N,4-dimethylcyclohexan-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | CNC1CCC(C)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H17N.C2HF3O2/c1-7-3-5-8(9-2)6-4-7;3-2(4,5)1(6)7/h7-9H,3-6H2,1-2H3;(H,6,7) |
| InChIKey | WLAQOGPJQJKZJF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |