C43H39N3O4S — CID 123297940
tert-butyl N-[3-[4-[2-[4-(2,2-dicyano-1-thiophen-2-ylethenyl)phenyl]-1-(4-methoxyphenyl)-2-phenylethenyl]phenoxy]propyl]carbamate (PubChem CID 123297940) has the molecular formula C43H39N3O4S and a molecular weight of 693.87 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-[4-(2,2-dicyano-1-thiophen-2-ylethenyl)phenyl]-1-(4-methoxyphenyl)-2-phenylethenyl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-[4-(2,2-dicyano-1-thiophen-2-ylethenyl)phenyl]-1-(4-methoxyphenyl)-2-phenylethenyl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 123297940 |
| Molecular Formula | C43H39N3O4S |
| Molecular Weight | 693.87 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | tert-butyl N-[3-[4-[2-[4-(2,2-dicyano-1-thiophen-2-ylethenyl)phenyl]-1-(4-methoxyphenyl)-2-phenylethenyl]phenoxy]propyl]carbamate |
| SMILES | COc1ccc(C(=C(c2ccccc2)c2ccc(C(=C(C#N)C#N)c3cccs3)cc2)c2ccc(OCCCNC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C43H39N3O4S/c1-43(2,3)50-42(47)46-25-9-26-49-37-23-19-34(20-24-37)41(33-17-21-36(48-4)22-18-33)40(30-10-6-5-7-11-30)32-15-13-31(14-16-32)39(35(28-44)29-45)38-12-8-27-51-38/h5-8,10-24,27H,9,25-26H2,1-4H3,(H,46,47) |
| InChIKey | UCLAISBFRAOLLS-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.87 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|