C42H31N3O4S — CID 129233887
2-[[4-[(Z)-2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]-2-(4-methoxyphenyl)-1-phenylethenyl]phenyl]-thiophen-2-ylmethylidene]propanedinitrile (PubChem CID 129233887) has the molecular formula C42H31N3O4S and a molecular weight of 673.79 g/mol. Its IUPAC name is 2-[[4-[(Z)-2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]-2-(4-methoxyphenyl)-1-phenylethenyl]phenyl]-thiophen-2-ylmethylidene]propanedinitrile.
| Compound Name | 2-[[4-[(Z)-2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]-2-(4-methoxyphenyl)-1-phenylethenyl]phenyl]-thiophen-2-ylmethylidene]propanedinitrile |
|---|---|
| PubChem CID | 129233887 |
| Molecular Formula | C42H31N3O4S |
| Molecular Weight | 673.79 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | 2-[[4-[(Z)-2-[4-[3-(2,5-dioxopyrrol-1-yl)propoxy]phenyl]-2-(4-methoxyphenyl)-1-phenylethenyl]phenyl]-thiophen-2-ylmethylidene]propanedinitrile |
| SMILES | COc1ccc(/C(=C(\c2ccccc2)c2ccc(C(=C(C#N)C#N)c3cccs3)cc2)c2ccc(OCCCN3C(=O)C=CC3=O)cc2)cc1 |
| InChI | InChI=1S/C42H31N3O4S/c1-48-35-18-14-32(15-19-35)42(33-16-20-36(21-17-33)49-25-6-24-45-38(46)22-23-39(45)47)41(29-7-3-2-4-8-29)31-12-10-30(11-13-31)40(34(27-43)28-44)37-9-5-26-50-37/h2-5,7-23,26H,6,24-25H2,1H3/b42-41- |
| InChIKey | AAHRYHQNLQCGDO-DYFOJMMBSA-N |
| XLogP | 8.31 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.79 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|