C11H18N3+ — CID 123300502
N-(1-but-2-enyl-1,4-dimethylpyrazin-1-ium-2-yl)methanimine (PubChem CID 123300502) has the molecular formula C11H18N3+ and a molecular weight of 192.29 g/mol. Its IUPAC name is N-(1-but-2-enyl-1,4-dimethylpyrazin-1-ium-2-yl)methanimine.
| Compound Name | N-(1-but-2-enyl-1,4-dimethylpyrazin-1-ium-2-yl)methanimine |
|---|---|
| PubChem CID | 123300502 |
| Molecular Formula | C11H18N3+ |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | N-(1-but-2-enyl-1,4-dimethylpyrazin-1-ium-2-yl)methanimine |
| SMILES | C=NC1=CN(C)C=C[N+]1(C)CC=CC |
| InChI | InChI=1S/C11H18N3/c1-5-6-8-14(4)9-7-13(3)10-11(14)12-2/h5-7,9-10H,2,8H2,1,3-4H3/q+1 |
| InChIKey | AALOFQXEZLFOTP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|